2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid

C13H15NO2S — CID 79819156

IUPAC2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid
SMILESCC(C)C(Cc1nc2ccccc2s1)C(=O)O
InChIInChI=1S/C13H15NO2S/c1-8(2)9(13(15)16)7-12-14-10-5-3-4-6-11(10)17-12/h3-6,8-9H,7H2,1-2H3,(H,15,16)
InChIKeyGELSNHPXMPQSHK-UHFFFAOYSA-N
MW249.34 g/mol
LogP3.20
Rot. Bonds4

About 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid

2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid (PubChem CID 79819156) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid
PubChem CID79819156
Molecular FormulaC13H15NO2S
Molecular Weight249.34 g/mol
Exact Mass249.08
IUPAC Name2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid
SMILESCC(C)C(Cc1nc2ccccc2s1)C(=O)O
InChIInChI=1S/C13H15NO2S/c1-8(2)9(13(15)16)7-12-14-10-5-3-4-6-11(10)17-12/h3-6,8-9H,7H2,1-2H3,(H,15,16)
InChIKeyGELSNHPXMPQSHK-UHFFFAOYSA-N
XLogP3.20
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.34
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid?
The IUPAC name of 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid (CID 79819156) is 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid.
What is the SMILES notation for 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid?
The canonical SMILES for 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid is CC(C)C(Cc1nc2ccccc2s1)C(=O)O.
What is the InChIKey of 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid?
The InChIKey is GELSNHPXMPQSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2S/c1-8(2)9(13(15)16)7-12-14-10-5-3-4-6-11(10)17-12/h3-6,8-9H,7H2,1-2H3,(H,15,16).
What are the key properties of 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid?
2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid has a molecular weight of 249.34 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-ylmethyl)-3-methylbutanoic acid is sourced from PubChem (CID 79819156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).