C15H10ClNO2S — CID 104631097
2-(1,3-benzothiazol-2-ylmethoxy)-6-chlorobenzaldehyde (PubChem CID 104631097) has the molecular formula C15H10ClNO2S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)-6-chlorobenzaldehyde.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethoxy)-6-chlorobenzaldehyde |
|---|---|
| PubChem CID | 104631097 |
| Molecular Formula | C15H10ClNO2S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethoxy)-6-chlorobenzaldehyde |
| SMILES | O=Cc1c(Cl)cccc1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10ClNO2S/c16-11-4-3-6-13(10(11)8-18)19-9-15-17-12-5-1-2-7-14(12)20-15/h1-8H,9H2 |
| InChIKey | BZQYEXGSYFOHNT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|