C15H10N2OS — CID 2714599
2-(1,3-benzothiazol-2-ylmethoxy)benzonitrile (PubChem CID 2714599) has the molecular formula C15H10N2OS and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)benzonitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 2714599 |
| Molecular Formula | C15H10N2OS |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccccc1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10N2OS/c16-9-11-5-1-3-7-13(11)18-10-15-17-12-6-2-4-8-14(12)19-15/h1-8H,10H2 |
| InChIKey | FEMFFQPWMIQMBB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |