C22H23N3O2S — CID 55940464
N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(2-cyanophenoxy)-3-methylbutanamide (PubChem CID 55940464) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(2-cyanophenoxy)-3-methylbutanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(2-cyanophenoxy)-3-methylbutanamide |
|---|---|
| PubChem CID | 55940464 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(2-cyanophenoxy)-3-methylbutanamide |
| SMILES | CC(C)C(Oc1ccccc1C#N)C(=O)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H23N3O2S/c1-15(2)21(27-18-10-5-3-8-16(18)14-23)22(26)24-13-7-12-20-25-17-9-4-6-11-19(17)28-20/h3-6,8-11,15,21H,7,12-13H2,1-2H3,(H,24,26) |
| InChIKey | GYCWODXMGNOUOK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|