C20H22FN3OS — CID 131903948
N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide (PubChem CID 131903948) has the molecular formula C20H22FN3OS and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 131903948 |
| Molecular Formula | C20H22FN3OS |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide |
| SMILES | CN(C)C(C(=O)NCCCc1nc2ccccc2s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FN3OS/c1-24(2)19(14-9-11-15(21)12-10-14)20(25)22-13-5-8-18-23-16-6-3-4-7-17(16)26-18/h3-4,6-7,9-12,19H,5,8,13H2,1-2H3,(H,22,25) |
| InChIKey | CBSPVKGRWHJHQV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|