C22H19FN2O3S — CID 43071369
N-[3-(1,3-benzothiazol-2-yl)propyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 43071369) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43071369 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(NCCCc1nc2ccccc2s1)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H19FN2O3S/c23-15-7-9-16(10-8-15)27-14-17-11-12-19(28-17)22(26)24-13-3-6-21-25-18-4-1-2-5-20(18)29-21/h1-2,4-5,7-12H,3,6,13-14H2,(H,24,26) |
| InChIKey | VXYPPYSROBHISP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|