C18H16FNO3S — CID 46423641
5-[(4-fluorophenoxy)methyl]-N-(2-thiophen-3-ylethyl)furan-2-carboxamide (PubChem CID 46423641) has the molecular formula C18H16FNO3S and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-(2-thiophen-3-ylethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-(2-thiophen-3-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 46423641 |
| Molecular Formula | C18H16FNO3S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-(2-thiophen-3-ylethyl)furan-2-carboxamide |
| SMILES | O=C(NCCc1ccsc1)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H16FNO3S/c19-14-1-3-15(4-2-14)22-11-16-5-6-17(23-16)18(21)20-9-7-13-8-10-24-12-13/h1-6,8,10,12H,7,9,11H2,(H,20,21) |
| InChIKey | ISBPICOMUMAMCS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |