C17H13BrN2O2S — CID 17434027
4-(1,3-benzothiazol-2-ylmethoxy)-3-bromo-5-ethoxybenzonitrile (PubChem CID 17434027) has the molecular formula C17H13BrN2O2S and a molecular weight of 389.27 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethoxy)-3-bromo-5-ethoxybenzonitrile.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethoxy)-3-bromo-5-ethoxybenzonitrile |
|---|---|
| PubChem CID | 17434027 |
| Molecular Formula | C17H13BrN2O2S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethoxy)-3-bromo-5-ethoxybenzonitrile |
| SMILES | CCOc1cc(C#N)cc(Br)c1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H13BrN2O2S/c1-2-21-14-8-11(9-19)7-12(18)17(14)22-10-16-20-13-5-3-4-6-15(13)23-16/h3-8H,2,10H2,1H3 |
| InChIKey | RORSGAPYVRLNDZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |