C16H12BrCl2NO2 — CID 91682193
3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxybenzonitrile (PubChem CID 91682193) has the molecular formula C16H12BrCl2NO2 and a molecular weight of 401.09 g/mol. Its IUPAC name is 3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxybenzonitrile.
| Compound Name | 3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxybenzonitrile |
|---|---|
| PubChem CID | 91682193 |
| Molecular Formula | C16H12BrCl2NO2 |
| Molecular Weight | 401.09 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | 3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxybenzonitrile |
| SMILES | CCOc1cc(C#N)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12BrCl2NO2/c1-2-21-15-6-10(8-20)5-13(17)16(15)22-9-11-3-4-12(18)7-14(11)19/h3-7H,2,9H2,1H3 |
| InChIKey | NOJPVNZCMHNYGC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.09 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |