C18H21BrCl2NO3+ — CID 2200478
[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl-(2-hydroxyethyl)azanium (PubChem CID 2200478) has the molecular formula C18H21BrCl2NO3+ and a molecular weight of 450.18 g/mol. Its IUPAC name is [3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl-(2-hydroxyethyl)azanium.
| Compound Name | [3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2200478 |
| Molecular Formula | C18H21BrCl2NO3+ |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | [3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl-(2-hydroxyethyl)azanium |
| SMILES | CCOc1cc(C[NH2+]CCO)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20BrCl2NO3/c1-2-24-17-8-12(10-22-5-6-23)7-15(19)18(17)25-11-13-3-4-14(20)9-16(13)21/h3-4,7-9,22-23H,2,5-6,10-11H2,1H3/p+1 |
| InChIKey | LSEBIOJOUZJDNG-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|