C16H15Cl2IO3 — CID 2933314
[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methanol (PubChem CID 2933314) has the molecular formula C16H15Cl2IO3 and a molecular weight of 453.10 g/mol. Its IUPAC name is [4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methanol.
| Compound Name | [4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methanol |
|---|---|
| PubChem CID | 2933314 |
| Molecular Formula | C16H15Cl2IO3 |
| Molecular Weight | 453.10 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | [4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methanol |
| SMILES | CCOc1cc(CO)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2IO3/c1-2-21-15-6-10(8-20)5-14(19)16(15)22-9-11-3-4-12(17)7-13(11)18/h3-7,20H,2,8-9H2,1H3 |
| InChIKey | RIJXPCDBBITVCA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.10 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|