C16H16ClIO3 — CID 45371652
[3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methanol (PubChem CID 45371652) has the molecular formula C16H16ClIO3 and a molecular weight of 418.66 g/mol. Its IUPAC name is [3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methanol.
| Compound Name | [3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 45371652 |
| Molecular Formula | C16H16ClIO3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | [3-chloro-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methanol |
| SMILES | CCOc1cc(CO)cc(Cl)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C16H16ClIO3/c1-2-20-15-8-12(9-19)7-14(17)16(15)21-10-11-3-5-13(18)6-4-11/h3-8,19H,2,9-10H2,1H3 |
| InChIKey | QPGOGERRHNWPNH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|