C14H11F2IO2 — CID 79888019
[3,5-difluoro-4-[(4-iodophenyl)methoxy]phenyl]methanol (PubChem CID 79888019) has the molecular formula C14H11F2IO2 and a molecular weight of 376.14 g/mol. Its IUPAC name is [3,5-difluoro-4-[(4-iodophenyl)methoxy]phenyl]methanol.
| Compound Name | [3,5-difluoro-4-[(4-iodophenyl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 79888019 |
| Molecular Formula | C14H11F2IO2 |
| Molecular Weight | 376.14 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | [3,5-difluoro-4-[(4-iodophenyl)methoxy]phenyl]methanol |
| SMILES | OCc1cc(F)c(OCc2ccc(I)cc2)c(F)c1 |
| InChI | InChI=1S/C14H11F2IO2/c15-12-5-10(7-18)6-13(16)14(12)19-8-9-1-3-11(17)4-2-9/h1-6,18H,7-8H2 |
| InChIKey | IVQMCSYNDVMWJI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|