C13H18F2O3 — CID 107704167
6-[2,6-difluoro-4-(hydroxymethyl)phenoxy]hexan-1-ol (PubChem CID 107704167) has the molecular formula C13H18F2O3 and a molecular weight of 260.28 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(hydroxymethyl)phenoxy]hexan-1-ol.
| Compound Name | 6-[2,6-difluoro-4-(hydroxymethyl)phenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 107704167 |
| Molecular Formula | C13H18F2O3 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 6-[2,6-difluoro-4-(hydroxymethyl)phenoxy]hexan-1-ol |
| SMILES | OCCCCCCOc1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C13H18F2O3/c14-11-7-10(9-17)8-12(15)13(11)18-6-4-2-1-3-5-16/h7-8,16-17H,1-6,9H2 |
| InChIKey | BACWOYLZAIGXOM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|