C16H25F2NO2 — CID 107702737
6-[2,6-difluoro-4-(propylaminomethyl)phenoxy]hexan-1-ol (PubChem CID 107702737) has the molecular formula C16H25F2NO2 and a molecular weight of 301.38 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(propylaminomethyl)phenoxy]hexan-1-ol.
| Compound Name | 6-[2,6-difluoro-4-(propylaminomethyl)phenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 107702737 |
| Molecular Formula | C16H25F2NO2 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 6-[2,6-difluoro-4-(propylaminomethyl)phenoxy]hexan-1-ol |
| SMILES | CCCNCc1cc(F)c(OCCCCCCO)c(F)c1 |
| InChI | InChI=1S/C16H25F2NO2/c1-2-7-19-12-13-10-14(17)16(15(18)11-13)21-9-6-4-3-5-8-20/h10-11,19-20H,2-9,12H2,1H3 |
| InChIKey | NFZCYSINDVATJW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|