C13H16F5NOS — CID 116615145
N-[[3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-1-amine (PubChem CID 116615145) has the molecular formula C13H16F5NOS and a molecular weight of 329.33 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 116615145 |
| Molecular Formula | C13H16F5NOS |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[[3,5-difluoro-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)c(OCCSC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H16F5NOS/c1-2-3-19-8-9-6-10(14)12(11(15)7-9)20-4-5-21-13(16,17)18/h6-7,19H,2-5,8H2,1H3 |
| InChIKey | SYARCMSXQGVRHZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|