C16H25F2NO2 — CID 114492193
1-[2,6-difluoro-4-(propylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol (PubChem CID 114492193) has the molecular formula C16H25F2NO2 and a molecular weight of 301.38 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(propylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol.
| Compound Name | 1-[2,6-difluoro-4-(propylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114492193 |
| Molecular Formula | C16H25F2NO2 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-[2,6-difluoro-4-(propylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol |
| SMILES | CCCNCc1cc(F)c(OCC(C)(O)C(C)C)c(F)c1 |
| InChI | InChI=1S/C16H25F2NO2/c1-5-6-19-9-12-7-13(17)15(14(18)8-12)21-10-16(4,20)11(2)3/h7-8,11,19-20H,5-6,9-10H2,1-4H3 |
| InChIKey | MAPVHDWEZZWSOP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|