C13H17F2NO — CID 79892254
N-[(3,5-difluoro-4-prop-2-enoxyphenyl)methyl]propan-1-amine (PubChem CID 79892254) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is N-[(3,5-difluoro-4-prop-2-enoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3,5-difluoro-4-prop-2-enoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79892254 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[(3,5-difluoro-4-prop-2-enoxyphenyl)methyl]propan-1-amine |
| SMILES | C=CCOc1c(F)cc(CNCCC)cc1F |
| InChI | InChI=1S/C13H17F2NO/c1-3-5-16-9-10-7-11(14)13(12(15)8-10)17-6-4-2/h4,7-8,16H,2-3,5-6,9H2,1H3 |
| InChIKey | NKWSPOAESWUNAY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|