C15H23F2NO2 — CID 79892333
5-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenoxy]pentan-1-ol (PubChem CID 79892333) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is 5-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenoxy]pentan-1-ol.
| Compound Name | 5-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenoxy]pentan-1-ol |
|---|---|
| PubChem CID | 79892333 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 5-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenoxy]pentan-1-ol |
| SMILES | CC(C)NCc1cc(F)c(OCCCCCO)c(F)c1 |
| InChI | InChI=1S/C15H23F2NO2/c1-11(2)18-10-12-8-13(16)15(14(17)9-12)20-7-5-3-4-6-19/h8-9,11,18-19H,3-7,10H2,1-2H3 |
| InChIKey | PTIOZNBHHVNFBZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|