C10H9BrF2O2 — CID 79887877
[4-(2-bromoprop-2-enoxy)-3,5-difluorophenyl]methanol (PubChem CID 79887877) has the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. Its IUPAC name is [4-(2-bromoprop-2-enoxy)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(2-bromoprop-2-enoxy)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 79887877 |
| Molecular Formula | C10H9BrF2O2 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | [4-(2-bromoprop-2-enoxy)-3,5-difluorophenyl]methanol |
| SMILES | C=C(Br)COc1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C10H9BrF2O2/c1-6(11)5-15-10-8(12)2-7(4-14)3-9(10)13/h2-3,14H,1,4-5H2 |
| InChIKey | ZFGHBOBDPIULPD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |