C14H17F2NO3 — CID 79888270
N-cyclopentyl-2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]acetamide (PubChem CID 79888270) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is N-cyclopentyl-2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]acetamide.
| Compound Name | N-cyclopentyl-2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 79888270 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-cyclopentyl-2-[2,6-difluoro-4-(hydroxymethyl)phenoxy]acetamide |
| SMILES | O=C(COc1c(F)cc(CO)cc1F)NC1CCCC1 |
| InChI | InChI=1S/C14H17F2NO3/c15-11-5-9(7-18)6-12(16)14(11)20-8-13(19)17-10-3-1-2-4-10/h5-6,10,18H,1-4,7-8H2,(H,17,19) |
| InChIKey | KTNFAKVEQNHOIU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |