C14H17F2NO2 — CID 78767908
N-cyclohexyl-2-(3,4-difluorophenoxy)acetamide (PubChem CID 78767908) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,4-difluorophenoxy)acetamide.
| Compound Name | N-cyclohexyl-2-(3,4-difluorophenoxy)acetamide |
|---|---|
| PubChem CID | 78767908 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-cyclohexyl-2-(3,4-difluorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(F)c(F)c1)NC1CCCCC1 |
| InChI | InChI=1S/C14H17F2NO2/c15-12-7-6-11(8-13(12)16)19-9-14(18)17-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H,17,18) |
| InChIKey | VZJHAXAREPGDAB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |