C22H23ClF2N2O4 — CID 121260487
2-(4-chlorophenoxy)-N-[4-[[2-(3,5-difluorophenoxy)acetyl]amino]cyclohexyl]acetamide (PubChem CID 121260487) has the molecular formula C22H23ClF2N2O4 and a molecular weight of 452.89 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[4-[[2-(3,5-difluorophenoxy)acetyl]amino]cyclohexyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[4-[[2-(3,5-difluorophenoxy)acetyl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 121260487 |
| Molecular Formula | C22H23ClF2N2O4 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-[[2-(3,5-difluorophenoxy)acetyl]amino]cyclohexyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NC1CCC(NC(=O)COc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C22H23ClF2N2O4/c23-14-1-7-19(8-2-14)30-12-21(28)26-17-3-5-18(6-4-17)27-22(29)13-31-20-10-15(24)9-16(25)11-20/h1-2,7-11,17-18H,3-6,12-13H2,(H,26,28)(H,27,29) |
| InChIKey | ULTGEUKDDQJIHT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |