C14H18ClIN2O2 — CID 155618732
2-(4-chlorophenoxy)-N-[4-(imino-λ3-iodanyl)cyclohexyl]acetamide (PubChem CID 155618732) has the molecular formula C14H18ClIN2O2 and a molecular weight of 408.67 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[4-(imino-λ3-iodanyl)cyclohexyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[4-(imino-λ3-iodanyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 155618732 |
| Molecular Formula | C14H18ClIN2O2 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-(imino-λ3-iodanyl)cyclohexyl]acetamide |
| SMILES | [H]/N=I/C1CCC(NC(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H18ClIN2O2/c15-10-1-7-13(8-2-10)20-9-14(19)18-12-5-3-11(16-17)4-6-12/h1-2,7-8,11-12,17H,3-6,9H2,(H,18,19) |
| InChIKey | KNTYDWLZIZQGTB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|