C23H24ClF2NO4 — CID 149043391
2-(4-chlorophenoxy)-N-[4-[3-(3,5-difluorophenoxy)-2-oxopropyl]cyclohexyl]acetamide (PubChem CID 149043391) has the molecular formula C23H24ClF2NO4 and a molecular weight of 451.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[4-[3-(3,5-difluorophenoxy)-2-oxopropyl]cyclohexyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[4-[3-(3,5-difluorophenoxy)-2-oxopropyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 149043391 |
| Molecular Formula | C23H24ClF2NO4 |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-[3-(3,5-difluorophenoxy)-2-oxopropyl]cyclohexyl]acetamide |
| SMILES | O=C(COc1cc(F)cc(F)c1)CC1CCC(NC(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H24ClF2NO4/c24-16-3-7-21(8-4-16)31-14-23(29)27-19-5-1-15(2-6-19)9-20(28)13-30-22-11-17(25)10-18(26)12-22/h3-4,7-8,10-12,15,19H,1-2,5-6,9,13-14H2,(H,27,29) |
| InChIKey | QIANDAFXGPEYKT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |