C24H27ClN2O6 — CID 158031609
2-(4-chloro-3-nitrophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide (PubChem CID 158031609) has the molecular formula C24H27ClN2O6 and a molecular weight of 474.94 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide.
| Compound Name | 2-(4-chloro-3-nitrophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 158031609 |
| Molecular Formula | C24H27ClN2O6 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-(4-chloro-3-nitrophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)CC2CCC(NC(=O)COc3ccc(Cl)c([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C24H27ClN2O6/c1-16-2-8-20(9-3-16)32-14-19(28)12-17-4-6-18(7-5-17)26-24(29)15-33-21-10-11-22(25)23(13-21)27(30)31/h2-3,8-11,13,17-18H,4-7,12,14-15H2,1H3,(H,26,29) |
| InChIKey | FAZQIHYGIWIPGU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|