C24H28INO4 — CID 159066552
2-(4-iodophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide (PubChem CID 159066552) has the molecular formula C24H28INO4 and a molecular weight of 521.40 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide.
| Compound Name | 2-(4-iodophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 159066552 |
| Molecular Formula | C24H28INO4 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-(4-iodophenoxy)-N-[4-[3-(4-methylphenoxy)-2-oxopropyl]cyclohexyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)CC2CCC(NC(=O)COc3ccc(I)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H28INO4/c1-17-2-10-22(11-3-17)29-15-21(27)14-18-4-8-20(9-5-18)26-24(28)16-30-23-12-6-19(25)7-13-23/h2-3,6-7,10-13,18,20H,4-5,8-9,14-16H2,1H3,(H,26,28) |
| InChIKey | JZDDWABLWNOENO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|