C33H43NO4Si2 — CID 153167840
N-[4-[2-oxo-3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]cyclohexyl]-2-[4-(2-trimethylsilylethynyl)phenoxy]acetamide (PubChem CID 153167840) has the molecular formula C33H43NO4Si2 and a molecular weight of 573.88 g/mol. Its IUPAC name is N-[4-[2-oxo-3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]cyclohexyl]-2-[4-(2-trimethylsilylethynyl)phenoxy]acetamide.
| Compound Name | N-[4-[2-oxo-3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]cyclohexyl]-2-[4-(2-trimethylsilylethynyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 153167840 |
| Molecular Formula | C33H43NO4Si2 |
| Molecular Weight | 573.88 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | N-[4-[2-oxo-3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]cyclohexyl]-2-[4-(2-trimethylsilylethynyl)phenoxy]acetamide |
| SMILES | C[Si](C)(C)C#Cc1ccc(OCC(=O)CC2CCC(NC(=O)COc3ccc(C#C[Si](C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H43NO4Si2/c1-39(2,3)21-19-26-9-15-31(16-10-26)37-24-30(35)23-28-7-13-29(14-8-28)34-33(36)25-38-32-17-11-27(12-18-32)20-22-40(4,5)6/h9-12,15-18,28-29H,7-8,13-14,23-25H2,1-6H3,(H,34,36) |
| InChIKey | WDPNGRPZUKZVIM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.88 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|