C27H34Cl2N2O4Si — CID 86269886
2-(4-chlorophenoxy)-N-[4-[[2-[4-chloro-3-(2-trimethylsilylethynyl)phenoxy]-1-hydroxyethyl]amino]cyclohexyl]acetamide (PubChem CID 86269886) has the molecular formula C27H34Cl2N2O4Si and a molecular weight of 549.57 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[4-[[2-[4-chloro-3-(2-trimethylsilylethynyl)phenoxy]-1-hydroxyethyl]amino]cyclohexyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[4-[[2-[4-chloro-3-(2-trimethylsilylethynyl)phenoxy]-1-hydroxyethyl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 86269886 |
| Molecular Formula | C27H34Cl2N2O4Si |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-[[2-[4-chloro-3-(2-trimethylsilylethynyl)phenoxy]-1-hydroxyethyl]amino]cyclohexyl]acetamide |
| SMILES | C[Si](C)(C)C#Cc1cc(OCC(O)NC2CCC(NC(=O)COc3ccc(Cl)cc3)CC2)ccc1Cl |
| InChI | InChI=1S/C27H34Cl2N2O4Si/c1-36(2,3)15-14-19-16-24(12-13-25(19)29)35-18-27(33)31-22-8-6-21(7-9-22)30-26(32)17-34-23-10-4-20(28)5-11-23/h4-5,10-13,16,21-22,27,31,33H,6-9,17-18H2,1-3H3,(H,30,32) |
| InChIKey | SAMFQMMLOIYOEK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|