C24H25ClN2O4 — CID 90446748
N-[4-[[2-(4-chlorophenoxy)acetyl]amino]cyclohexyl]-2-(4-ethynylphenoxy)acetamide (PubChem CID 90446748) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is N-[4-[[2-(4-chlorophenoxy)acetyl]amino]cyclohexyl]-2-(4-ethynylphenoxy)acetamide.
| Compound Name | N-[4-[[2-(4-chlorophenoxy)acetyl]amino]cyclohexyl]-2-(4-ethynylphenoxy)acetamide |
|---|---|
| PubChem CID | 90446748 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[4-[[2-(4-chlorophenoxy)acetyl]amino]cyclohexyl]-2-(4-ethynylphenoxy)acetamide |
| SMILES | C#Cc1ccc(OCC(=O)NC2CCC(NC(=O)COc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H25ClN2O4/c1-2-17-3-11-21(12-4-17)30-15-23(28)26-19-7-9-20(10-8-19)27-24(29)16-31-22-13-5-18(25)6-14-22/h1,3-6,11-14,19-20H,7-10,15-16H2,(H,26,28)(H,27,29) |
| InChIKey | NOCUICMZMXVUMN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|