C16H22ClN4O4+ — CID 9053233
[2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium (PubChem CID 9053233) has the molecular formula C16H22ClN4O4+ and a molecular weight of 369.83 g/mol. Its IUPAC name is [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9053233 |
| Molecular Formula | C16H22ClN4O4+ |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NNC(=O)COc1ccc(Cl)cc1)CC(=O)NC1CC1 |
| InChI | InChI=1S/C16H21ClN4O4/c1-21(8-14(22)18-12-4-5-12)9-15(23)19-20-16(24)10-25-13-6-2-11(17)3-7-13/h2-3,6-7,12H,4-5,8-10H2,1H3,(H,18,22)(H,19,23)(H,20,24)/p+1 |
| InChIKey | YTOVZWYUUHQFEN-UHFFFAOYSA-O |
| XLogP | -1.34 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|