C18H20ClFN3O3+ — CID 8709229
[2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium (PubChem CID 8709229) has the molecular formula C18H20ClFN3O3+ and a molecular weight of 380.83 g/mol. Its IUPAC name is [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium.
| Compound Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8709229 |
| Molecular Formula | C18H20ClFN3O3+ |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NNC(=O)COc1ccc(Cl)cc1)Cc1ccccc1F |
| InChI | InChI=1S/C18H19ClFN3O3/c1-23(10-13-4-2-3-5-16(13)20)11-17(24)21-22-18(25)12-26-15-8-6-14(19)7-9-15/h2-9H,10-12H2,1H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | SHIVSZQHGDRXJQ-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|