C17H25ClN3O3+ — CID 7998367
[2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-cyclohexyl-methylazanium (PubChem CID 7998367) has the molecular formula C17H25ClN3O3+ and a molecular weight of 354.86 g/mol. Its IUPAC name is [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-cyclohexyl-methylazanium.
| Compound Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-cyclohexyl-methylazanium |
|---|---|
| PubChem CID | 7998367 |
| Molecular Formula | C17H25ClN3O3+ |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-cyclohexyl-methylazanium |
| SMILES | C[NH+](CC(=O)NNC(=O)COc1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-21(14-5-3-2-4-6-14)11-16(22)19-20-17(23)12-24-15-9-7-13(18)8-10-15/h7-10,14H,2-6,11-12H2,1H3,(H,19,22)(H,20,23)/p+1 |
| InChIKey | DESPVMJIQGPRJF-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|