C17H16ClFN2O4 — CID 7927413
(2S)-N'-[2-(4-chlorophenoxy)acetyl]-2-(2-fluorophenoxy)propanehydrazide (PubChem CID 7927413) has the molecular formula C17H16ClFN2O4 and a molecular weight of 366.78 g/mol. Its IUPAC name is (2S)-N'-[2-(4-chlorophenoxy)acetyl]-2-(2-fluorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[2-(4-chlorophenoxy)acetyl]-2-(2-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 7927413 |
| Molecular Formula | C17H16ClFN2O4 |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2S)-N'-[2-(4-chlorophenoxy)acetyl]-2-(2-fluorophenoxy)propanehydrazide |
| SMILES | C[C@H](Oc1ccccc1F)C(=O)NNC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClFN2O4/c1-11(25-15-5-3-2-4-14(15)19)17(23)21-20-16(22)10-24-13-8-6-12(18)7-9-13/h2-9,11H,10H2,1H3,(H,20,22)(H,21,23)/t11-/m0/s1 |
| InChIKey | MGCUIIUTZFPRJF-NSHDSACASA-N |
| XLogP | 2.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|