C17H15Cl2FN2O3 — CID 7760988
(2S)-N'-[2-(2,6-dichlorophenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide (PubChem CID 7760988) has the molecular formula C17H15Cl2FN2O3 and a molecular weight of 385.22 g/mol. Its IUPAC name is (2S)-N'-[2-(2,6-dichlorophenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[2-(2,6-dichlorophenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 7760988 |
| Molecular Formula | C17H15Cl2FN2O3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (2S)-N'-[2-(2,6-dichlorophenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide |
| SMILES | C[C@H](Oc1ccccc1F)C(=O)NNC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H15Cl2FN2O3/c1-10(25-15-8-3-2-7-14(15)20)17(24)22-21-16(23)9-11-12(18)5-4-6-13(11)19/h2-8,10H,9H2,1H3,(H,21,23)(H,22,24)/t10-/m0/s1 |
| InChIKey | RTYVNZPWKQLLTP-JTQLQIEISA-N |
| XLogP | 3.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|