C18H18ClFN2O4 — CID 9087471
(2S)-N'-[2-(5-chloro-2-methoxyphenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide (PubChem CID 9087471) has the molecular formula C18H18ClFN2O4 and a molecular weight of 380.80 g/mol. Its IUPAC name is (2S)-N'-[2-(5-chloro-2-methoxyphenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[2-(5-chloro-2-methoxyphenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9087471 |
| Molecular Formula | C18H18ClFN2O4 |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (2S)-N'-[2-(5-chloro-2-methoxyphenyl)acetyl]-2-(2-fluorophenoxy)propanehydrazide |
| SMILES | COc1ccc(Cl)cc1CC(=O)NNC(=O)[C@H](C)Oc1ccccc1F |
| InChI | InChI=1S/C18H18ClFN2O4/c1-11(26-16-6-4-3-5-14(16)20)18(24)22-21-17(23)10-12-9-13(19)7-8-15(12)25-2/h3-9,11H,10H2,1-2H3,(H,21,23)(H,22,24)/t11-/m0/s1 |
| InChIKey | GGIZRWOVARZRGW-NSHDSACASA-N |
| XLogP | 2.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|