C18H17Cl2FN2O3 — CID 46569105
N'-[3-(2,4-dichlorophenyl)propanoyl]-2-(2-fluorophenoxy)propanehydrazide (PubChem CID 46569105) has the molecular formula C18H17Cl2FN2O3 and a molecular weight of 399.25 g/mol. Its IUPAC name is N'-[3-(2,4-dichlorophenyl)propanoyl]-2-(2-fluorophenoxy)propanehydrazide.
| Compound Name | N'-[3-(2,4-dichlorophenyl)propanoyl]-2-(2-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 46569105 |
| Molecular Formula | C18H17Cl2FN2O3 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N'-[3-(2,4-dichlorophenyl)propanoyl]-2-(2-fluorophenoxy)propanehydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2FN2O3/c1-11(26-16-5-3-2-4-15(16)21)18(25)23-22-17(24)9-7-12-6-8-13(19)10-14(12)20/h2-6,8,10-11H,7,9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | VWYZDHZHFRAXRQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|