C19H18Cl3N3O4 — CID 5120294
N-(2-chlorophenyl)-4-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-4-oxobutanamide (PubChem CID 5120294) has the molecular formula C19H18Cl3N3O4 and a molecular weight of 458.73 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2-chlorophenyl)-4-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 5120294 |
| Molecular Formula | C19H18Cl3N3O4 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | N-(2-chlorophenyl)-4-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-4-oxobutanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)CCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H18Cl3N3O4/c1-11(29-16-7-6-12(20)10-14(16)22)19(28)25-24-18(27)9-8-17(26)23-15-5-3-2-4-13(15)21/h2-7,10-11H,8-9H2,1H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | MQMLEABMTXAOFJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|