C20H21Cl2N3O4 — CID 4931366
N-(2,4-dichlorophenyl)-4-[2-[2-(3-methylphenoxy)propanoyl]hydrazinyl]-4-oxobutanamide (PubChem CID 4931366) has the molecular formula C20H21Cl2N3O4 and a molecular weight of 438.31 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-[2-[2-(3-methylphenoxy)propanoyl]hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-[2-[2-(3-methylphenoxy)propanoyl]hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 4931366 |
| Molecular Formula | C20H21Cl2N3O4 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-[2-[2-(3-methylphenoxy)propanoyl]hydrazinyl]-4-oxobutanamide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)CCC(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3O4/c1-12-4-3-5-15(10-12)29-13(2)20(28)25-24-19(27)9-8-18(26)23-17-7-6-14(21)11-16(17)22/h3-7,10-11,13H,8-9H2,1-2H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | RXAYLXZAZMUCHW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|