C21H18ClFN2O3 — CID 7760909
(2R)-N'-[2-(2-chloro-6-fluorophenyl)acetyl]-2-naphthalen-2-yloxypropanehydrazide (PubChem CID 7760909) has the molecular formula C21H18ClFN2O3 and a molecular weight of 400.84 g/mol. Its IUPAC name is (2R)-N'-[2-(2-chloro-6-fluorophenyl)acetyl]-2-naphthalen-2-yloxypropanehydrazide.
| Compound Name | (2R)-N'-[2-(2-chloro-6-fluorophenyl)acetyl]-2-naphthalen-2-yloxypropanehydrazide |
|---|---|
| PubChem CID | 7760909 |
| Molecular Formula | C21H18ClFN2O3 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (2R)-N'-[2-(2-chloro-6-fluorophenyl)acetyl]-2-naphthalen-2-yloxypropanehydrazide |
| SMILES | C[C@@H](Oc1ccc2ccccc2c1)C(=O)NNC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C21H18ClFN2O3/c1-13(28-16-10-9-14-5-2-3-6-15(14)11-16)21(27)25-24-20(26)12-17-18(22)7-4-8-19(17)23/h2-11,13H,12H2,1H3,(H,24,26)(H,25,27)/t13-/m1/s1 |
| InChIKey | DKFWTNDBSURDTO-CYBMUJFWSA-N |
| XLogP | 3.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|