C27H25ClF3N3O4 — CID 157410225
2-[4-chloro-3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]-N-[4-[3-(4-ethynylphenoxy)-2-oxopropyl]cyclohexyl]acetamide (PubChem CID 157410225) has the molecular formula C27H25ClF3N3O4 and a molecular weight of 547.96 g/mol. Its IUPAC name is 2-[4-chloro-3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]-N-[4-[3-(4-ethynylphenoxy)-2-oxopropyl]cyclohexyl]acetamide.
| Compound Name | 2-[4-chloro-3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]-N-[4-[3-(4-ethynylphenoxy)-2-oxopropyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 157410225 |
| Molecular Formula | C27H25ClF3N3O4 |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-[4-chloro-3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]-N-[4-[3-(4-ethynylphenoxy)-2-oxopropyl]cyclohexyl]acetamide |
| SMILES | C#Cc1ccc(OCC(=O)CC2CCC(NC(=O)COc3ccc(Cl)c(C4(C(F)(F)F)N=N4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H25ClF3N3O4/c1-2-17-5-9-21(10-6-17)37-15-20(35)13-18-3-7-19(8-4-18)32-25(36)16-38-22-11-12-24(28)23(14-22)26(33-34-26)27(29,30)31/h1,5-6,9-12,14,18-19H,3-4,7-8,13,15-16H2,(H,32,36) |
| InChIKey | BOEQREFFPXNBMC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|