C25H27FN2O4 — CID 163557537
2-(4-ethynylphenoxy)-N-[1-[3-(3-fluoro-4-methylphenoxy)-2-oxopropyl]piperidin-4-yl]acetamide (PubChem CID 163557537) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 2-(4-ethynylphenoxy)-N-[1-[3-(3-fluoro-4-methylphenoxy)-2-oxopropyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(4-ethynylphenoxy)-N-[1-[3-(3-fluoro-4-methylphenoxy)-2-oxopropyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 163557537 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-(4-ethynylphenoxy)-N-[1-[3-(3-fluoro-4-methylphenoxy)-2-oxopropyl]piperidin-4-yl]acetamide |
| SMILES | C#Cc1ccc(OCC(=O)NC2CCN(CC(=O)COc3ccc(C)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C25H27FN2O4/c1-3-19-5-8-22(9-6-19)32-17-25(30)27-20-10-12-28(13-11-20)15-21(29)16-31-23-7-4-18(2)24(26)14-23/h1,4-9,14,20H,10-13,15-17H2,2H3,(H,27,30) |
| InChIKey | PCTHMKFOXYDZKM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|