C14H15F2NO4 — CID 79884320
4-[2-(cyclopentylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid (PubChem CID 79884320) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is 4-[2-(cyclopentylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid.
| Compound Name | 4-[2-(cyclopentylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 79884320 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-[2-(cyclopentylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid |
| SMILES | O=C(COc1c(F)cc(C(=O)O)cc1F)NC1CCCC1 |
| InChI | InChI=1S/C14H15F2NO4/c15-10-5-8(14(19)20)6-11(16)13(10)21-7-12(18)17-9-3-1-2-4-9/h5-6,9H,1-4,7H2,(H,17,18)(H,19,20) |
| InChIKey | AVEBZTWJIVGACP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |