C14H18Br2N2O2 — CID 43351708
2-(4-amino-2,6-dibromophenoxy)-N-cyclohexylacetamide (PubChem CID 43351708) has the molecular formula C14H18Br2N2O2 and a molecular weight of 406.12 g/mol. Its IUPAC name is 2-(4-amino-2,6-dibromophenoxy)-N-cyclohexylacetamide.
| Compound Name | 2-(4-amino-2,6-dibromophenoxy)-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 43351708 |
| Molecular Formula | C14H18Br2N2O2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 2-(4-amino-2,6-dibromophenoxy)-N-cyclohexylacetamide |
| SMILES | Nc1cc(Br)c(OCC(=O)NC2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H18Br2N2O2/c15-11-6-9(17)7-12(16)14(11)20-8-13(19)18-10-4-2-1-3-5-10/h6-7,10H,1-5,8,17H2,(H,18,19) |
| InChIKey | HKFXZZGORMAZNS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|