C13H14F2N2O2 — CID 79887552
[3,5-difluoro-4-(3-imidazol-1-ylpropoxy)phenyl]methanol (PubChem CID 79887552) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is [3,5-difluoro-4-(3-imidazol-1-ylpropoxy)phenyl]methanol.
| Compound Name | [3,5-difluoro-4-(3-imidazol-1-ylpropoxy)phenyl]methanol |
|---|---|
| PubChem CID | 79887552 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [3,5-difluoro-4-(3-imidazol-1-ylpropoxy)phenyl]methanol |
| SMILES | OCc1cc(F)c(OCCCn2ccnc2)c(F)c1 |
| InChI | InChI=1S/C13H14F2N2O2/c14-11-6-10(8-18)7-12(15)13(11)19-5-1-3-17-4-2-16-9-17/h2,4,6-7,9,18H,1,3,5,8H2 |
| InChIKey | HHRLNCUMAPHPFH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|