C17H24N2O — CID 2850907
1-[5-(2,4,6-trimethylphenoxy)pentyl]imidazole (PubChem CID 2850907) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[5-(2,4,6-trimethylphenoxy)pentyl]imidazole.
| Compound Name | 1-[5-(2,4,6-trimethylphenoxy)pentyl]imidazole |
|---|---|
| PubChem CID | 2850907 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-[5-(2,4,6-trimethylphenoxy)pentyl]imidazole |
| SMILES | Cc1cc(C)c(OCCCCCn2ccnc2)c(C)c1 |
| InChI | InChI=1S/C17H24N2O/c1-14-11-15(2)17(16(3)12-14)20-10-6-4-5-8-19-9-7-18-13-19/h7,9,11-13H,4-6,8,10H2,1-3H3 |
| InChIKey | IGHGIZWSPOWWJX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|