C16H23ClN2O — CID 2851015
1-[4-(2,4,6-trimethylphenoxy)butyl]imidazole;hydrochloride (PubChem CID 2851015) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 1-[4-(2,4,6-trimethylphenoxy)butyl]imidazole;hydrochloride.
| Compound Name | 1-[4-(2,4,6-trimethylphenoxy)butyl]imidazole;hydrochloride |
|---|---|
| PubChem CID | 2851015 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-[4-(2,4,6-trimethylphenoxy)butyl]imidazole;hydrochloride |
| SMILES | Cc1cc(C)c(OCCCCn2ccnc2)c(C)c1.Cl |
| InChI | InChI=1S/C16H22N2O.ClH/c1-13-10-14(2)16(15(3)11-13)19-9-5-4-7-18-8-6-17-12-18;/h6,8,10-12H,4-5,7,9H2,1-3H3;1H |
| InChIKey | CXJWABRXAXYUMN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|