C18H26N2O — CID 2852343
1-[3-[2,6-di(propan-2-yl)phenoxy]propyl]imidazole (PubChem CID 2852343) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[3-[2,6-di(propan-2-yl)phenoxy]propyl]imidazole.
| Compound Name | 1-[3-[2,6-di(propan-2-yl)phenoxy]propyl]imidazole |
|---|---|
| PubChem CID | 2852343 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-[3-[2,6-di(propan-2-yl)phenoxy]propyl]imidazole |
| SMILES | CC(C)c1cccc(C(C)C)c1OCCCn1ccnc1 |
| InChI | InChI=1S/C18H26N2O/c1-14(2)16-7-5-8-17(15(3)4)18(16)21-12-6-10-20-11-9-19-13-20/h5,7-9,11,13-15H,6,10,12H2,1-4H3 |
| InChIKey | ZYIFSTIQKASYGM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|