C18H26F4O4 — CID 177082644
6-[2,3,5,6-tetrafluoro-4-(6-hydroxyhexoxy)phenoxy]hexan-1-ol (PubChem CID 177082644) has the molecular formula C18H26F4O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 6-[2,3,5,6-tetrafluoro-4-(6-hydroxyhexoxy)phenoxy]hexan-1-ol.
| Compound Name | 6-[2,3,5,6-tetrafluoro-4-(6-hydroxyhexoxy)phenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 177082644 |
| Molecular Formula | C18H26F4O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 6-[2,3,5,6-tetrafluoro-4-(6-hydroxyhexoxy)phenoxy]hexan-1-ol |
| SMILES | OCCCCCCOc1c(F)c(F)c(OCCCCCCO)c(F)c1F |
| InChI | InChI=1S/C18H26F4O4/c19-13-15(21)18(26-12-8-4-2-6-10-24)16(22)14(20)17(13)25-11-7-3-1-5-9-23/h23-24H,1-12H2 |
| InChIKey | ZGMKFBDTDWQXFK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|