C14H4F10O2 — CID 2833797
1,2,3,4,5-pentafluoro-6-[2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzene (PubChem CID 2833797) has the molecular formula C14H4F10O2 and a molecular weight of 394.16 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 2833797 |
| Molecular Formula | C14H4F10O2 |
| Molecular Weight | 394.16 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzene |
| SMILES | Fc1c(F)c(F)c(OCCOc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H4F10O2/c15-3-5(17)9(21)13(10(22)6(3)18)25-1-2-26-14-11(23)7(19)4(16)8(20)12(14)24/h1-2H2 |
| InChIKey | QSJVZCCLBKWTHH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.16 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|